C17H19ClO — CID 116542288
1-(2-chlorophenyl)-1-(3-propylphenyl)ethanol (PubChem CID 116542288) has the molecular formula C17H19ClO and a molecular weight of 274.79 g/mol. Its IUPAC name is 1-(2-chlorophenyl)-1-(3-propylphenyl)ethanol.
| Compound Name | 1-(2-chlorophenyl)-1-(3-propylphenyl)ethanol |
|---|---|
| PubChem CID | 116542288 |
| Molecular Formula | C17H19ClO |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 1-(2-chlorophenyl)-1-(3-propylphenyl)ethanol |
| SMILES | CCCc1cccc(C(C)(O)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C17H19ClO/c1-3-7-13-8-6-9-14(12-13)17(2,19)15-10-4-5-11-16(15)18/h4-6,8-12,19H,3,7H2,1-2H3 |
| InChIKey | HLCCJJPIKYRPSV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |