C16H20F6O2 — CID 20728984
1-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3-propylbenzene (PubChem CID 20728984) has the molecular formula C16H20F6O2 and a molecular weight of 358.32 g/mol. Its IUPAC name is 1-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3-propylbenzene.
| Compound Name | 1-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3-propylbenzene |
|---|---|
| PubChem CID | 20728984 |
| Molecular Formula | C16H20F6O2 |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-[2-(1-ethoxyethoxy)-1,1,1,3,3,3-hexafluoropropan-2-yl]-3-propylbenzene |
| SMILES | CCCc1cccc(C(OC(C)OCC)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F6O2/c1-4-7-12-8-6-9-13(10-12)14(15(17,18)19,16(20,21)22)24-11(3)23-5-2/h6,8-11H,4-5,7H2,1-3H3 |
| InChIKey | HAJXBHZGNURJES-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|