C20H23F3O2 — CID 159790830
1-(diethoxymethyl)-2-methyl-4-[[3-(trifluoromethyl)phenyl]methyl]benzene (PubChem CID 159790830) has the molecular formula C20H23F3O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 1-(diethoxymethyl)-2-methyl-4-[[3-(trifluoromethyl)phenyl]methyl]benzene.
| Compound Name | 1-(diethoxymethyl)-2-methyl-4-[[3-(trifluoromethyl)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 159790830 |
| Molecular Formula | C20H23F3O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-(diethoxymethyl)-2-methyl-4-[[3-(trifluoromethyl)phenyl]methyl]benzene |
| SMILES | CCOC(OCC)c1ccc(Cc2cccc(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C20H23F3O2/c1-4-24-19(25-5-2)18-10-9-16(11-14(18)3)12-15-7-6-8-17(13-15)20(21,22)23/h6-11,13,19H,4-5,12H2,1-3H3 |
| InChIKey | JCPNWDZWJJMGDR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|