C16H12F6O — CID 138534397
1-methyl-2-(trifluoromethoxy)-4-[[3-(trifluoromethyl)phenyl]methyl]benzene (PubChem CID 138534397) has the molecular formula C16H12F6O and a molecular weight of 334.26 g/mol. Its IUPAC name is 1-methyl-2-(trifluoromethoxy)-4-[[3-(trifluoromethyl)phenyl]methyl]benzene.
| Compound Name | 1-methyl-2-(trifluoromethoxy)-4-[[3-(trifluoromethyl)phenyl]methyl]benzene |
|---|---|
| PubChem CID | 138534397 |
| Molecular Formula | C16H12F6O |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 1-methyl-2-(trifluoromethoxy)-4-[[3-(trifluoromethyl)phenyl]methyl]benzene |
| SMILES | Cc1ccc(Cc2cccc(C(F)(F)F)c2)cc1OC(F)(F)F |
| InChI | InChI=1S/C16H12F6O/c1-10-5-6-12(9-14(10)23-16(20,21)22)7-11-3-2-4-13(8-11)15(17,18)19/h2-6,8-9H,7H2,1H3 |
| InChIKey | LWRFUJUMHUPQPD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |