C32H31ClF6N2O3 — CID 161426183
2-(diethoxymethyl)-5-[[3-(trifluoromethyl)phenyl]methyl]pyridine;5-[[3-(trifluoromethyl)phenyl]methyl]pyridine-2-carbaldehyde;hydrochloride (PubChem CID 161426183) has the molecular formula C32H31ClF6N2O3 and a molecular weight of 641.05 g/mol. Its IUPAC name is 2-(diethoxymethyl)-5-[[3-(trifluoromethyl)phenyl]methyl]pyridine;5-[[3-(trifluoromethyl)phenyl]methyl]pyridine-2-carbaldehyde;hydrochloride.
| Compound Name | 2-(diethoxymethyl)-5-[[3-(trifluoromethyl)phenyl]methyl]pyridine;5-[[3-(trifluoromethyl)phenyl]methyl]pyridine-2-carbaldehyde;hydrochloride |
|---|---|
| PubChem CID | 161426183 |
| Molecular Formula | C32H31ClF6N2O3 |
| Molecular Weight | 641.05 g/mol |
| Exact Mass | 640.19 |
| IUPAC Name | 2-(diethoxymethyl)-5-[[3-(trifluoromethyl)phenyl]methyl]pyridine;5-[[3-(trifluoromethyl)phenyl]methyl]pyridine-2-carbaldehyde;hydrochloride |
| SMILES | CCOC(OCC)c1ccc(Cc2cccc(C(F)(F)F)c2)cn1.Cl.O=Cc1ccc(Cc2cccc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C18H20F3NO2.C14H10F3NO.ClH/c1-3-23-17(24-4-2)16-9-8-14(12-22-16)10-13-6-5-7-15(11-13)18(19,20)21;15-14(16,17)12-3-1-2-10(7-12)6-11-4-5-13(9-19)18-8-11;/h5-9,11-12,17H,3-4,10H2,1-2H3;1-5,7-9H,6H2;1H |
| InChIKey | SOADSTNHKJDMDR-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.05 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|