C19H22F3NO2 — CID 58877126
4-(diethoxymethyl)-3-methyl-N-[3-(trifluoromethyl)phenyl]aniline (PubChem CID 58877126) has the molecular formula C19H22F3NO2 and a molecular weight of 353.38 g/mol. Its IUPAC name is 4-(diethoxymethyl)-3-methyl-N-[3-(trifluoromethyl)phenyl]aniline.
| Compound Name | 4-(diethoxymethyl)-3-methyl-N-[3-(trifluoromethyl)phenyl]aniline |
|---|---|
| PubChem CID | 58877126 |
| Molecular Formula | C19H22F3NO2 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-(diethoxymethyl)-3-methyl-N-[3-(trifluoromethyl)phenyl]aniline |
| SMILES | CCOC(OCC)c1ccc(Nc2cccc(C(F)(F)F)c2)cc1C |
| InChI | InChI=1S/C19H22F3NO2/c1-4-24-18(25-5-2)17-10-9-16(11-13(17)3)23-15-8-6-7-14(12-15)19(20,21)22/h6-12,18,23H,4-5H2,1-3H3 |
| InChIKey | BFTJXMJGZGRGNB-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|