C16H21F3N2O4 — CID 172894057
N-(3,3-diethoxypropyl)-N'-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 172894057) has the molecular formula C16H21F3N2O4 and a molecular weight of 362.35 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-N'-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-(3,3-diethoxypropyl)-N'-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 172894057 |
| Molecular Formula | C16H21F3N2O4 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | N-(3,3-diethoxypropyl)-N'-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | CCOC(CCNC(=O)C(=O)Nc1cccc(C(F)(F)F)c1)OCC |
| InChI | InChI=1S/C16H21F3N2O4/c1-3-24-13(25-4-2)8-9-20-14(22)15(23)21-12-7-5-6-11(10-12)16(17,18)19/h5-7,10,13H,3-4,8-9H2,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | PJGYCZCUQNUJRX-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|