C16H21F3N2O3 — CID 111490713
N-(4-hydroxy-2,2-dimethylpentyl)-N'-[3-(trifluoromethyl)phenyl]oxamide (PubChem CID 111490713) has the molecular formula C16H21F3N2O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is N-(4-hydroxy-2,2-dimethylpentyl)-N'-[3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N-(4-hydroxy-2,2-dimethylpentyl)-N'-[3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 111490713 |
| Molecular Formula | C16H21F3N2O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | N-(4-hydroxy-2,2-dimethylpentyl)-N'-[3-(trifluoromethyl)phenyl]oxamide |
| SMILES | CC(O)CC(C)(C)CNC(=O)C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H21F3N2O3/c1-10(22)8-15(2,3)9-20-13(23)14(24)21-12-6-4-5-11(7-12)16(17,18)19/h4-7,10,22H,8-9H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | VRBWPNOXVNNQDY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|