C17H26N2O3 — CID 111490702
N'-(3,4-dimethylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide (PubChem CID 111490702) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is N'-(3,4-dimethylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide.
| Compound Name | N'-(3,4-dimethylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide |
|---|---|
| PubChem CID | 111490702 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N'-(3,4-dimethylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)NCC(C)(C)CC(C)O)cc1C |
| InChI | InChI=1S/C17H26N2O3/c1-11-6-7-14(8-12(11)2)19-16(22)15(21)18-10-17(4,5)9-13(3)20/h6-8,13,20H,9-10H2,1-5H3,(H,18,21)(H,19,22) |
| InChIKey | PJYVVMOWLITCCO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|