C16H23FN2O3 — CID 111490740
N'-(4-fluoro-2-methylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide (PubChem CID 111490740) has the molecular formula C16H23FN2O3 and a molecular weight of 310.37 g/mol. Its IUPAC name is N'-(4-fluoro-2-methylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide.
| Compound Name | N'-(4-fluoro-2-methylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide |
|---|---|
| PubChem CID | 111490740 |
| Molecular Formula | C16H23FN2O3 |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N'-(4-fluoro-2-methylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide |
| SMILES | Cc1cc(F)ccc1NC(=O)C(=O)NCC(C)(C)CC(C)O |
| InChI | InChI=1S/C16H23FN2O3/c1-10-7-12(17)5-6-13(10)19-15(22)14(21)18-9-16(3,4)8-11(2)20/h5-7,11,20H,8-9H2,1-4H3,(H,18,21)(H,19,22) |
| InChIKey | HXDKYCZQPUQDQD-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|