C19H30N2O3 — CID 111490731
N'-(4-butylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide (PubChem CID 111490731) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is N'-(4-butylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide.
| Compound Name | N'-(4-butylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide |
|---|---|
| PubChem CID | 111490731 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | N'-(4-butylphenyl)-N-(4-hydroxy-2,2-dimethylpentyl)oxamide |
| SMILES | CCCCc1ccc(NC(=O)C(=O)NCC(C)(C)CC(C)O)cc1 |
| InChI | InChI=1S/C19H30N2O3/c1-5-6-7-15-8-10-16(11-9-15)21-18(24)17(23)20-13-19(3,4)12-14(2)22/h8-11,14,22H,5-7,12-13H2,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | WYBNNSWYYISAEK-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|