C17H28N2O2 — CID 111473397
1-(4-hydroxy-2,2-dimethylpentyl)-3-(3-propan-2-ylphenyl)urea (PubChem CID 111473397) has the molecular formula C17H28N2O2 and a molecular weight of 292.42 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylpentyl)-3-(3-propan-2-ylphenyl)urea.
| Compound Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-(3-propan-2-ylphenyl)urea |
|---|---|
| PubChem CID | 111473397 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-(3-propan-2-ylphenyl)urea |
| SMILES | CC(O)CC(C)(C)CNC(=O)Nc1cccc(C(C)C)c1 |
| InChI | InChI=1S/C17H28N2O2/c1-12(2)14-7-6-8-15(9-14)19-16(21)18-11-17(4,5)10-13(3)20/h6-9,12-13,20H,10-11H2,1-5H3,(H2,18,19,21) |
| InChIKey | SVFPYEJPRVAURY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |