C17H28N2O3 — CID 111474442
1-[3-(ethoxymethyl)phenyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea (PubChem CID 111474442) has the molecular formula C17H28N2O3 and a molecular weight of 308.42 g/mol. Its IUPAC name is 1-[3-(ethoxymethyl)phenyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea.
| Compound Name | 1-[3-(ethoxymethyl)phenyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111474442 |
| Molecular Formula | C17H28N2O3 |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | 1-[3-(ethoxymethyl)phenyl]-3-(4-hydroxy-2,2-dimethylpentyl)urea |
| SMILES | CCOCc1cccc(NC(=O)NCC(C)(C)CC(C)O)c1 |
| InChI | InChI=1S/C17H28N2O3/c1-5-22-11-14-7-6-8-15(9-14)19-16(21)18-12-17(3,4)10-13(2)20/h6-9,13,20H,5,10-12H2,1-4H3,(H2,18,19,21) |
| InChIKey | SKFRKFLMEHFYFA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |