C21H28N2O2 — CID 111503860
1-benzhydryl-3-(4-hydroxy-2,2-dimethylpentyl)urea (PubChem CID 111503860) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is 1-benzhydryl-3-(4-hydroxy-2,2-dimethylpentyl)urea.
| Compound Name | 1-benzhydryl-3-(4-hydroxy-2,2-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111503860 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | 1-benzhydryl-3-(4-hydroxy-2,2-dimethylpentyl)urea |
| SMILES | CC(O)CC(C)(C)CNC(=O)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H28N2O2/c1-16(24)14-21(2,3)15-22-20(25)23-19(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,16,19,24H,14-15H2,1-3H3,(H2,22,23,25) |
| InChIKey | HCHCSGWOAJMUCJ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |