C18H30N2O2 — CID 111504028
1-(4-hydroxy-2,2-dimethylpentyl)-3-[1-(4-methylphenyl)propyl]urea (PubChem CID 111504028) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-(4-hydroxy-2,2-dimethylpentyl)-3-[1-(4-methylphenyl)propyl]urea.
| Compound Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[1-(4-methylphenyl)propyl]urea |
|---|---|
| PubChem CID | 111504028 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | 1-(4-hydroxy-2,2-dimethylpentyl)-3-[1-(4-methylphenyl)propyl]urea |
| SMILES | CCC(NC(=O)NCC(C)(C)CC(C)O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H30N2O2/c1-6-16(15-9-7-13(2)8-10-15)20-17(22)19-12-18(4,5)11-14(3)21/h7-10,14,16,21H,6,11-12H2,1-5H3,(H2,19,20,22) |
| InChIKey | LPTFYSJSFAGOEL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |