C15H23BrN2O2 — CID 111473086
1-(2-bromo-4-methylphenyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea (PubChem CID 111473086) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.27 g/mol. Its IUPAC name is 1-(2-bromo-4-methylphenyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea.
| Compound Name | 1-(2-bromo-4-methylphenyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea |
|---|---|
| PubChem CID | 111473086 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.27 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 1-(2-bromo-4-methylphenyl)-3-(4-hydroxy-2,2-dimethylpentyl)urea |
| SMILES | Cc1ccc(NC(=O)NCC(C)(C)CC(C)O)c(Br)c1 |
| InChI | InChI=1S/C15H23BrN2O2/c1-10-5-6-13(12(16)7-10)18-14(20)17-9-15(3,4)8-11(2)19/h5-7,11,19H,8-9H2,1-4H3,(H2,17,18,20) |
| InChIKey | HDIKVMMPESJMDZ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |