C18H24N2O3 — CID 111504031
1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[1-(4-methylphenyl)propyl]urea (PubChem CID 111504031) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[1-(4-methylphenyl)propyl]urea.
| Compound Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[1-(4-methylphenyl)propyl]urea |
|---|---|
| PubChem CID | 111504031 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[1-(4-methylphenyl)propyl]urea |
| SMILES | CCC(NC(=O)NCC(C)(O)c1ccco1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H24N2O3/c1-4-15(14-9-7-13(2)8-10-14)20-17(21)19-12-18(3,22)16-6-5-11-23-16/h5-11,15,22H,4,12H2,1-3H3,(H2,19,20,21) |
| InChIKey | NHSBYLUJLJJPFB-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |