C16H20N2O3 — CID 111478738
1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(1-phenylethyl)urea (PubChem CID 111478738) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(1-phenylethyl)urea.
| Compound Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(1-phenylethyl)urea |
|---|---|
| PubChem CID | 111478738 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-(1-phenylethyl)urea |
| SMILES | CC(NC(=O)NCC(C)(O)c1ccco1)c1ccccc1 |
| InChI | InChI=1S/C16H20N2O3/c1-12(13-7-4-3-5-8-13)18-15(19)17-11-16(2,20)14-9-6-10-21-14/h3-10,12,20H,11H2,1-2H3,(H2,17,18,19) |
| InChIKey | XKYUYBDHUZUAIB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |