C15H26N2O4 — CID 111480769
1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[1-(2-methylpropoxy)propan-2-yl]urea (PubChem CID 111480769) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[1-(2-methylpropoxy)propan-2-yl]urea.
| Compound Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[1-(2-methylpropoxy)propan-2-yl]urea |
|---|---|
| PubChem CID | 111480769 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1-[2-(furan-2-yl)-2-hydroxypropyl]-3-[1-(2-methylpropoxy)propan-2-yl]urea |
| SMILES | CC(C)COCC(C)NC(=O)NCC(C)(O)c1ccco1 |
| InChI | InChI=1S/C15H26N2O4/c1-11(2)8-20-9-12(3)17-14(18)16-10-15(4,19)13-6-5-7-21-13/h5-7,11-12,19H,8-10H2,1-4H3,(H2,16,17,18) |
| InChIKey | SZCHXKGGNBKJGD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |