C15H25NO4 — CID 111482542
N-[2-(furan-2-yl)-2-hydroxypropyl]-2-(3-methylbutoxy)propanamide (PubChem CID 111482542) has the molecular formula C15H25NO4 and a molecular weight of 283.37 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-2-hydroxypropyl]-2-(3-methylbutoxy)propanamide.
| Compound Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-2-(3-methylbutoxy)propanamide |
|---|---|
| PubChem CID | 111482542 |
| Molecular Formula | C15H25NO4 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | N-[2-(furan-2-yl)-2-hydroxypropyl]-2-(3-methylbutoxy)propanamide |
| SMILES | CC(C)CCOC(C)C(=O)NCC(C)(O)c1ccco1 |
| InChI | InChI=1S/C15H25NO4/c1-11(2)7-9-19-12(3)14(17)16-10-15(4,18)13-6-5-8-20-13/h5-6,8,11-12,18H,7,9-10H2,1-4H3,(H,16,17) |
| InChIKey | IYFSYXLTQHQWLI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |