C16H24N2O5 — CID 172894059
N-(3,3-diethoxypropyl)-N'-(3-methoxyphenyl)oxamide (PubChem CID 172894059) has the molecular formula C16H24N2O5 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-(3,3-diethoxypropyl)-N'-(3-methoxyphenyl)oxamide.
| Compound Name | N-(3,3-diethoxypropyl)-N'-(3-methoxyphenyl)oxamide |
|---|---|
| PubChem CID | 172894059 |
| Molecular Formula | C16H24N2O5 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | N-(3,3-diethoxypropyl)-N'-(3-methoxyphenyl)oxamide |
| SMILES | CCOC(CCNC(=O)C(=O)Nc1cccc(OC)c1)OCC |
| InChI | InChI=1S/C16H24N2O5/c1-4-22-14(23-5-2)9-10-17-15(19)16(20)18-12-7-6-8-13(11-12)21-3/h6-8,11,14H,4-5,9-10H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | UNEISPXQYSIEAL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|