C13H20N3O3+ — CID 2268249
2-[[2-(3-methoxyanilino)-2-oxoacetyl]amino]ethyl-dimethylazanium (PubChem CID 2268249) has the molecular formula C13H20N3O3+ and a molecular weight of 266.32 g/mol. Its IUPAC name is 2-[[2-(3-methoxyanilino)-2-oxoacetyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[2-(3-methoxyanilino)-2-oxoacetyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 2268249 |
| Molecular Formula | C13H20N3O3+ |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 2-[[2-(3-methoxyanilino)-2-oxoacetyl]amino]ethyl-dimethylazanium |
| SMILES | COc1cccc(NC(=O)C(=O)NCC[NH+](C)C)c1 |
| InChI | InChI=1S/C13H19N3O3/c1-16(2)8-7-14-12(17)13(18)15-10-5-4-6-11(9-10)19-3/h4-6,9H,7-8H2,1-3H3,(H,14,17)(H,15,18)/p+1 |
| InChIKey | MITXIMIMVNRHIC-UHFFFAOYSA-O |
| XLogP | -1.11 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|