C13H19ClN3O2+ — CID 7541412
3-[[2-(3-chloroanilino)-2-oxoacetyl]amino]propyl-dimethylazanium (PubChem CID 7541412) has the molecular formula C13H19ClN3O2+ and a molecular weight of 284.77 g/mol. Its IUPAC name is 3-[[2-(3-chloroanilino)-2-oxoacetyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[2-(3-chloroanilino)-2-oxoacetyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7541412 |
| Molecular Formula | C13H19ClN3O2+ |
| Molecular Weight | 284.77 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 3-[[2-(3-chloroanilino)-2-oxoacetyl]amino]propyl-dimethylazanium |
| SMILES | C[NH+](C)CCCNC(=O)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C13H18ClN3O2/c1-17(2)8-4-7-15-12(18)13(19)16-11-6-3-5-10(14)9-11/h3,5-6,9H,4,7-8H2,1-2H3,(H,15,18)(H,16,19)/p+1 |
| InChIKey | LKUOMJSIWXMQTM-UHFFFAOYSA-O |
| XLogP | -0.07 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.77 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|