C17H16ClN3O3 — CID 4297035
N-[2-(3-chloroanilino)-2-oxoethyl]-N'-(3-methylphenyl)oxamide (PubChem CID 4297035) has the molecular formula C17H16ClN3O3 and a molecular weight of 345.79 g/mol. Its IUPAC name is N-[2-(3-chloroanilino)-2-oxoethyl]-N'-(3-methylphenyl)oxamide.
| Compound Name | N-[2-(3-chloroanilino)-2-oxoethyl]-N'-(3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 4297035 |
| Molecular Formula | C17H16ClN3O3 |
| Molecular Weight | 345.79 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | N-[2-(3-chloroanilino)-2-oxoethyl]-N'-(3-methylphenyl)oxamide |
| SMILES | Cc1cccc(NC(=O)C(=O)NCC(=O)Nc2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C17H16ClN3O3/c1-11-4-2-6-13(8-11)21-17(24)16(23)19-10-15(22)20-14-7-3-5-12(18)9-14/h2-9H,10H2,1H3,(H,19,23)(H,20,22)(H,21,24) |
| InChIKey | VGHWTURTWOCOBI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.79 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|