C12H15ClN2O4 — CID 7292715
N'-(3-chlorophenyl)-N-(2,2-dimethoxyethyl)oxamide (PubChem CID 7292715) has the molecular formula C12H15ClN2O4 and a molecular weight of 286.72 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-N-(2,2-dimethoxyethyl)oxamide.
| Compound Name | N'-(3-chlorophenyl)-N-(2,2-dimethoxyethyl)oxamide |
|---|---|
| PubChem CID | 7292715 |
| Molecular Formula | C12H15ClN2O4 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.07 |
| IUPAC Name | N'-(3-chlorophenyl)-N-(2,2-dimethoxyethyl)oxamide |
| SMILES | COC(CNC(=O)C(=O)Nc1cccc(Cl)c1)OC |
| InChI | InChI=1S/C12H15ClN2O4/c1-18-10(19-2)7-14-11(16)12(17)15-9-5-3-4-8(13)6-9/h3-6,10H,7H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | SVFQJIAIAOPQMM-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|