C12H17ClN3O2+ — CID 7292713
2-[[2-(3-chloroanilino)-2-oxoacetyl]amino]ethyl-dimethylazanium (PubChem CID 7292713) has the molecular formula C12H17ClN3O2+ and a molecular weight of 270.74 g/mol. Its IUPAC name is 2-[[2-(3-chloroanilino)-2-oxoacetyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[2-(3-chloroanilino)-2-oxoacetyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7292713 |
| Molecular Formula | C12H17ClN3O2+ |
| Molecular Weight | 270.74 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | 2-[[2-(3-chloroanilino)-2-oxoacetyl]amino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CCNC(=O)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H16ClN3O2/c1-16(2)7-6-14-11(17)12(18)15-10-5-3-4-9(13)8-10/h3-5,8H,6-7H2,1-2H3,(H,14,17)(H,15,18)/p+1 |
| InChIKey | CTOORUVDPLFNDS-UHFFFAOYSA-O |
| XLogP | -0.46 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.74 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|