C11H11ClN2O2 — CID 2058074
N'-(3-chlorophenyl)-N-prop-2-enyloxamide (PubChem CID 2058074) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-N-prop-2-enyloxamide.
| Compound Name | N'-(3-chlorophenyl)-N-prop-2-enyloxamide |
|---|---|
| PubChem CID | 2058074 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | N'-(3-chlorophenyl)-N-prop-2-enyloxamide |
| SMILES | C=CCNC(=O)C(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C11H11ClN2O2/c1-2-6-13-10(15)11(16)14-9-5-3-4-8(12)7-9/h2-5,7H,1,6H2,(H,13,15)(H,14,16) |
| InChIKey | GYYIFNCREMZMSU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|