C13H16Cl2N2O2 — CID 4625739
N'-(3,5-dichlorophenyl)-N-pentyloxamide (PubChem CID 4625739) has the molecular formula C13H16Cl2N2O2 and a molecular weight of 303.19 g/mol. Its IUPAC name is N'-(3,5-dichlorophenyl)-N-pentyloxamide.
| Compound Name | N'-(3,5-dichlorophenyl)-N-pentyloxamide |
|---|---|
| PubChem CID | 4625739 |
| Molecular Formula | C13H16Cl2N2O2 |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | N'-(3,5-dichlorophenyl)-N-pentyloxamide |
| SMILES | CCCCCNC(=O)C(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C13H16Cl2N2O2/c1-2-3-4-5-16-12(18)13(19)17-11-7-9(14)6-10(15)8-11/h6-8H,2-5H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | STDYBOYTIYGPAA-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|