C14H20N2O5 — CID 18983780
N-hexyl-N'-(3,4,5-trihydroxyphenyl)oxamide (PubChem CID 18983780) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is N-hexyl-N'-(3,4,5-trihydroxyphenyl)oxamide.
| Compound Name | N-hexyl-N'-(3,4,5-trihydroxyphenyl)oxamide |
|---|---|
| PubChem CID | 18983780 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-hexyl-N'-(3,4,5-trihydroxyphenyl)oxamide |
| SMILES | CCCCCCNC(=O)C(=O)Nc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C14H20N2O5/c1-2-3-4-5-6-15-13(20)14(21)16-9-7-10(17)12(19)11(18)8-9/h7-8,17-19H,2-6H2,1H3,(H,15,20)(H,16,21) |
| InChIKey | RZJBICOEBMBUPE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|