C26H33N3O4 — CID 135298855
N-octyl-N'-[4-[[4-(2-oxopropanoylamino)phenyl]methyl]phenyl]oxamide (PubChem CID 135298855) has the molecular formula C26H33N3O4 and a molecular weight of 451.57 g/mol. Its IUPAC name is N-octyl-N'-[4-[[4-(2-oxopropanoylamino)phenyl]methyl]phenyl]oxamide.
| Compound Name | N-octyl-N'-[4-[[4-(2-oxopropanoylamino)phenyl]methyl]phenyl]oxamide |
|---|---|
| PubChem CID | 135298855 |
| Molecular Formula | C26H33N3O4 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | N-octyl-N'-[4-[[4-(2-oxopropanoylamino)phenyl]methyl]phenyl]oxamide |
| SMILES | CCCCCCCCNC(=O)C(=O)Nc1ccc(Cc2ccc(NC(=O)C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C26H33N3O4/c1-3-4-5-6-7-8-17-27-25(32)26(33)29-23-15-11-21(12-16-23)18-20-9-13-22(14-10-20)28-24(31)19(2)30/h9-16H,3-8,17-18H2,1-2H3,(H,27,32)(H,28,31)(H,29,33) |
| InChIKey | DRXSQVKHXNTWNY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|