C18H29ClN2O — CID 4294975
1-(3-chlorophenyl)-3-undecylurea (PubChem CID 4294975) has the molecular formula C18H29ClN2O and a molecular weight of 324.90 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-undecylurea.
| Compound Name | 1-(3-chlorophenyl)-3-undecylurea |
|---|---|
| PubChem CID | 4294975 |
| Molecular Formula | C18H29ClN2O |
| Molecular Weight | 324.90 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-(3-chlorophenyl)-3-undecylurea |
| SMILES | CCCCCCCCCCCNC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C18H29ClN2O/c1-2-3-4-5-6-7-8-9-10-14-20-18(22)21-17-13-11-12-16(19)15-17/h11-13,15H,2-10,14H2,1H3,(H2,20,21,22) |
| InChIKey | DGUQHZNZWZXKNB-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.90 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|