C15H22N3O4+ — CID 7160825
N'-(3-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)oxamide (PubChem CID 7160825) has the molecular formula C15H22N3O4+ and a molecular weight of 308.36 g/mol. Its IUPAC name is N'-(3-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)oxamide.
| Compound Name | N'-(3-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 7160825 |
| Molecular Formula | C15H22N3O4+ |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | N'-(3-methoxyphenyl)-N-(2-morpholin-4-ium-4-ylethyl)oxamide |
| SMILES | COc1cccc(NC(=O)C(=O)NCC[NH+]2CCOCC2)c1 |
| InChI | InChI=1S/C15H21N3O4/c1-21-13-4-2-3-12(11-13)17-15(20)14(19)16-5-6-18-7-9-22-10-8-18/h2-4,11H,5-10H2,1H3,(H,16,19)(H,17,20)/p+1 |
| InChIKey | KWSKFBVKTBWUBJ-UHFFFAOYSA-O |
| XLogP | -1.34 |
| TPSA | 81.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|