C15H23N2O3S+ — CID 7332467
2,4-dimethoxy-N-(2-morpholin-4-ium-4-ylethyl)benzenecarbothioamide (PubChem CID 7332467) has the molecular formula C15H23N2O3S+ and a molecular weight of 311.43 g/mol. Its IUPAC name is 2,4-dimethoxy-N-(2-morpholin-4-ium-4-ylethyl)benzenecarbothioamide.
| Compound Name | 2,4-dimethoxy-N-(2-morpholin-4-ium-4-ylethyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 7332467 |
| Molecular Formula | C15H23N2O3S+ |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2,4-dimethoxy-N-(2-morpholin-4-ium-4-ylethyl)benzenecarbothioamide |
| SMILES | COc1ccc(C(=S)NCC[NH+]2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O3S/c1-18-12-3-4-13(14(11-12)19-2)15(21)16-5-6-17-7-9-20-10-8-17/h3-4,11H,5-10H2,1-2H3,(H,16,21)/p+1 |
| InChIKey | ULBLGNYDLSTFLJ-UHFFFAOYSA-O |
| XLogP | -0.12 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|