C15H23N2O3+ — CID 4694933
2-(4-methylphenoxy)-N-(2-morpholin-4-ium-4-ylethyl)acetamide (PubChem CID 4694933) has the molecular formula C15H23N2O3+ and a molecular weight of 279.36 g/mol. Its IUPAC name is 2-(4-methylphenoxy)-N-(2-morpholin-4-ium-4-ylethyl)acetamide.
| Compound Name | 2-(4-methylphenoxy)-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 4694933 |
| Molecular Formula | C15H23N2O3+ |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | 2-(4-methylphenoxy)-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
| SMILES | Cc1ccc(OCC(=O)NCC[NH+]2CCOCC2)cc1 |
| InChI | InChI=1S/C15H22N2O3/c1-13-2-4-14(5-3-13)20-12-15(18)16-6-7-17-8-10-19-11-9-17/h2-5H,6-12H2,1H3,(H,16,18)/p+1 |
| InChIKey | GIOUPAZLSGXRBH-UHFFFAOYSA-O |
| XLogP | -0.59 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |