C19H30N3O5S+ — CID 7457741
2-[4-(cyclopentylsulfamoyl)phenoxy]-N-(2-morpholin-4-ium-4-ylethyl)acetamide (PubChem CID 7457741) has the molecular formula C19H30N3O5S+ and a molecular weight of 412.53 g/mol. Its IUPAC name is 2-[4-(cyclopentylsulfamoyl)phenoxy]-N-(2-morpholin-4-ium-4-ylethyl)acetamide.
| Compound Name | 2-[4-(cyclopentylsulfamoyl)phenoxy]-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 7457741 |
| Molecular Formula | C19H30N3O5S+ |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 2-[4-(cyclopentylsulfamoyl)phenoxy]-N-(2-morpholin-4-ium-4-ylethyl)acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)NC2CCCC2)cc1)NCC[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H29N3O5S/c23-19(20-9-10-22-11-13-26-14-12-22)15-27-17-5-7-18(8-6-17)28(24,25)21-16-3-1-2-4-16/h5-8,16,21H,1-4,9-15H2,(H,20,23)/p+1 |
| InChIKey | DBPPOGBMQBGIKH-UHFFFAOYSA-O |
| XLogP | -0.68 |
| TPSA | 98.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |