C24H32N2O6S — CID 45374682
2-[4-(cyclohexylsulfamoyl)phenoxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide (PubChem CID 45374682) has the molecular formula C24H32N2O6S and a molecular weight of 476.60 g/mol. Its IUPAC name is 2-[4-(cyclohexylsulfamoyl)phenoxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[4-(cyclohexylsulfamoyl)phenoxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 45374682 |
| Molecular Formula | C24H32N2O6S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 2-[4-(cyclohexylsulfamoyl)phenoxy]-N-[2-(3,4-dimethoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccc(CCNC(=O)COc2ccc(S(=O)(=O)NC3CCCCC3)cc2)cc1OC |
| InChI | InChI=1S/C24H32N2O6S/c1-30-22-13-8-18(16-23(22)31-2)14-15-25-24(27)17-32-20-9-11-21(12-10-20)33(28,29)26-19-6-4-3-5-7-19/h8-13,16,19,26H,3-7,14-15,17H2,1-2H3,(H,25,27) |
| InChIKey | RPETYXTZUROWID-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |