C20H26N2O4 — CID 71745859
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-(dimethylamino)phenoxy]acetamide (PubChem CID 71745859) has the molecular formula C20H26N2O4 and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-(dimethylamino)phenoxy]acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-(dimethylamino)phenoxy]acetamide |
|---|---|
| PubChem CID | 71745859 |
| Molecular Formula | C20H26N2O4 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-[4-(dimethylamino)phenoxy]acetamide |
| SMILES | COc1ccc(CCNC(=O)COc2ccc(N(C)C)cc2)cc1OC |
| InChI | InChI=1S/C20H26N2O4/c1-22(2)16-6-8-17(9-7-16)26-14-20(23)21-12-11-15-5-10-18(24-3)19(13-15)25-4/h5-10,13H,11-12,14H2,1-4H3,(H,21,23) |
| InChIKey | ITXXOWJWTLZITF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|