C18H20INO4 — CID 34578953
N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-iodophenoxy)acetamide (PubChem CID 34578953) has the molecular formula C18H20INO4 and a molecular weight of 441.27 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-iodophenoxy)acetamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-iodophenoxy)acetamide |
|---|---|
| PubChem CID | 34578953 |
| Molecular Formula | C18H20INO4 |
| Molecular Weight | 441.27 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-2-(3-iodophenoxy)acetamide |
| SMILES | COc1ccc(CCNC(=O)COc2cccc(I)c2)cc1OC |
| InChI | InChI=1S/C18H20INO4/c1-22-16-7-6-13(10-17(16)23-2)8-9-20-18(21)12-24-15-5-3-4-14(19)11-15/h3-7,10-11H,8-9,12H2,1-2H3,(H,20,21) |
| InChIKey | PKSKXALQFPDSRL-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|