C11H14INO2 — CID 60626728
2-(3-iodophenoxy)-N-propylacetamide (PubChem CID 60626728) has the molecular formula C11H14INO2 and a molecular weight of 319.14 g/mol. Its IUPAC name is 2-(3-iodophenoxy)-N-propylacetamide.
| Compound Name | 2-(3-iodophenoxy)-N-propylacetamide |
|---|---|
| PubChem CID | 60626728 |
| Molecular Formula | C11H14INO2 |
| Molecular Weight | 319.14 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 2-(3-iodophenoxy)-N-propylacetamide |
| SMILES | CCCNC(=O)COc1cccc(I)c1 |
| InChI | InChI=1S/C11H14INO2/c1-2-6-13-11(14)8-15-10-5-3-4-9(12)7-10/h3-5,7H,2,6,8H2,1H3,(H,13,14) |
| InChIKey | QHVRAMPCRAJNCC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.14 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|