C15H23N2O4+ — CID 4742368
N-(2,4-dimethoxyphenyl)-3-morpholin-4-ium-4-ylpropanamide (PubChem CID 4742368) has the molecular formula C15H23N2O4+ and a molecular weight of 295.36 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-morpholin-4-ium-4-ylpropanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-morpholin-4-ium-4-ylpropanamide |
|---|---|
| PubChem CID | 4742368 |
| Molecular Formula | C15H23N2O4+ |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-morpholin-4-ium-4-ylpropanamide |
| SMILES | COc1ccc(NC(=O)CC[NH+]2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C15H22N2O4/c1-19-12-3-4-13(14(11-12)20-2)16-15(18)5-6-17-7-9-21-10-8-17/h3-4,11H,5-10H2,1-2H3,(H,16,18)/p+1 |
| InChIKey | CUTHMKQBRIUQAD-UHFFFAOYSA-O |
| XLogP | -0.05 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |