C19H30N3O6+ — CID 7422216
(2S)-4-(2,5-dimethoxyanilino)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-oxobutanoate (PubChem CID 7422216) has the molecular formula C19H30N3O6+ and a molecular weight of 396.46 g/mol. Its IUPAC name is (2S)-4-(2,5-dimethoxyanilino)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-oxobutanoate.
| Compound Name | (2S)-4-(2,5-dimethoxyanilino)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7422216 |
| Molecular Formula | C19H30N3O6+ |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | (2S)-4-(2,5-dimethoxyanilino)-2-(3-morpholin-4-ium-4-ylpropylazaniumyl)-4-oxobutanoate |
| SMILES | COc1ccc(OC)c(NC(=O)C[C@H]([NH2+]CCC[NH+]2CCOCC2)C(=O)[O-])c1 |
| InChI | InChI=1S/C19H29N3O6/c1-26-14-4-5-17(27-2)15(12-14)21-18(23)13-16(19(24)25)20-6-3-7-22-8-10-28-11-9-22/h4-5,12,16,20H,3,6-11,13H2,1-2H3,(H,21,23)(H,24,25)/p+1/t16-/m0/s1 |
| InChIKey | FIBVYANJRMKQAY-INIZCTEOSA-O |
| XLogP | -2.98 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|