C23H33N3O3+2 — CID 2452826
[(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl]-(3-morpholin-4-ium-4-ylpropyl)azanium (PubChem CID 2452826) has the molecular formula C23H33N3O3+2 and a molecular weight of 399.54 g/mol. Its IUPAC name is [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl]-(3-morpholin-4-ium-4-ylpropyl)azanium.
| Compound Name | [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl]-(3-morpholin-4-ium-4-ylpropyl)azanium |
|---|---|
| PubChem CID | 2452826 |
| Molecular Formula | C23H33N3O3+2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.25 |
| IUPAC Name | [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl]-(3-morpholin-4-ium-4-ylpropyl)azanium |
| SMILES | COc1ccc(C)cc1NC(=O)[C@@H]([NH2+]CCC[NH+]1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C23H31N3O3/c1-18-9-10-21(28-2)20(17-18)25-23(27)22(19-7-4-3-5-8-19)24-11-6-12-26-13-15-29-16-14-26/h3-5,7-10,17,22,24H,6,11-16H2,1-2H3,(H,25,27)/p+2/t22-/m0/s1 |
| InChIKey | WSADDCPRMZXYML-QFIPXVFZSA-P |
| XLogP | 0.55 |
| TPSA | 68.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|