C20H22NO6- — CID 4285611
4-(2,5-dimethoxyanilino)-2-[(2-methoxyphenyl)methyl]-4-oxobutanoate (PubChem CID 4285611) has the molecular formula C20H22NO6- and a molecular weight of 372.40 g/mol. Its IUPAC name is 4-(2,5-dimethoxyanilino)-2-[(2-methoxyphenyl)methyl]-4-oxobutanoate.
| Compound Name | 4-(2,5-dimethoxyanilino)-2-[(2-methoxyphenyl)methyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 4285611 |
| Molecular Formula | C20H22NO6- |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 4-(2,5-dimethoxyanilino)-2-[(2-methoxyphenyl)methyl]-4-oxobutanoate |
| SMILES | COc1ccc(OC)c(NC(=O)CC(Cc2ccccc2OC)C(=O)[O-])c1 |
| InChI | InChI=1S/C20H23NO6/c1-25-15-8-9-18(27-3)16(12-15)21-19(22)11-14(20(23)24)10-13-6-4-5-7-17(13)26-2/h4-9,12,14H,10-11H2,1-3H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | TVYNRPAAXFWNCS-UHFFFAOYSA-M |
| XLogP | 1.65 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |