C24H27N2O3+ — CID 8730102
benzhydryl-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-methylazanium (PubChem CID 8730102) has the molecular formula C24H27N2O3+ and a molecular weight of 391.49 g/mol. Its IUPAC name is benzhydryl-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-methylazanium.
| Compound Name | benzhydryl-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8730102 |
| Molecular Formula | C24H27N2O3+ |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | benzhydryl-[2-(2,5-dimethoxyanilino)-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(OC)c(NC(=O)C[NH+](C)C(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H26N2O3/c1-26(17-23(27)25-21-16-20(28-2)14-15-22(21)29-3)24(18-10-6-4-7-11-18)19-12-8-5-9-13-19/h4-16,24H,17H2,1-3H3,(H,25,27)/p+1 |
| InChIKey | WAXFZIFUUATLLF-UHFFFAOYSA-O |
| XLogP | 2.95 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |