C20H22NO5- — CID 7349075
(3R)-4-(2,5-dimethoxyanilino)-3-[(4-methylphenyl)methyl]-4-oxobutanoate (PubChem CID 7349075) has the molecular formula C20H22NO5- and a molecular weight of 356.40 g/mol. Its IUPAC name is (3R)-4-(2,5-dimethoxyanilino)-3-[(4-methylphenyl)methyl]-4-oxobutanoate.
| Compound Name | (3R)-4-(2,5-dimethoxyanilino)-3-[(4-methylphenyl)methyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 7349075 |
| Molecular Formula | C20H22NO5- |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | (3R)-4-(2,5-dimethoxyanilino)-3-[(4-methylphenyl)methyl]-4-oxobutanoate |
| SMILES | COc1ccc(OC)c(NC(=O)[C@@H](CC(=O)[O-])Cc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C20H23NO5/c1-13-4-6-14(7-5-13)10-15(11-19(22)23)20(24)21-17-12-16(25-2)8-9-18(17)26-3/h4-9,12,15H,10-11H2,1-3H3,(H,21,24)(H,22,23)/p-1/t15-/m1/s1 |
| InChIKey | PFWWSPWXOKFXDK-OAHLLOKOSA-M |
| XLogP | 1.95 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |