C18H17ClNO3- — CID 6940823
(3R)-4-(4-chloroanilino)-3-[(4-methylphenyl)methyl]-4-oxobutanoate (PubChem CID 6940823) has the molecular formula C18H17ClNO3- and a molecular weight of 330.79 g/mol. Its IUPAC name is (3R)-4-(4-chloroanilino)-3-[(4-methylphenyl)methyl]-4-oxobutanoate.
| Compound Name | (3R)-4-(4-chloroanilino)-3-[(4-methylphenyl)methyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 6940823 |
| Molecular Formula | C18H17ClNO3- |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | (3R)-4-(4-chloroanilino)-3-[(4-methylphenyl)methyl]-4-oxobutanoate |
| SMILES | Cc1ccc(C[C@H](CC(=O)[O-])C(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H18ClNO3/c1-12-2-4-13(5-3-12)10-14(11-17(21)22)18(23)20-16-8-6-15(19)7-9-16/h2-9,14H,10-11H2,1H3,(H,20,23)(H,21,22)/p-1/t14-/m1/s1 |
| InChIKey | IKWJFAZZSCWTDM-CQSZACIVSA-M |
| XLogP | 2.59 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |