C17H14ClN2O5- — CID 7446194
(3R)-3-[(4-chlorophenyl)methyl]-4-(4-nitroanilino)-4-oxobutanoate (PubChem CID 7446194) has the molecular formula C17H14ClN2O5- and a molecular weight of 361.76 g/mol. Its IUPAC name is (3R)-3-[(4-chlorophenyl)methyl]-4-(4-nitroanilino)-4-oxobutanoate.
| Compound Name | (3R)-3-[(4-chlorophenyl)methyl]-4-(4-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7446194 |
| Molecular Formula | C17H14ClN2O5- |
| Molecular Weight | 361.76 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | (3R)-3-[(4-chlorophenyl)methyl]-4-(4-nitroanilino)-4-oxobutanoate |
| SMILES | O=C([O-])C[C@@H](Cc1ccc(Cl)cc1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15ClN2O5/c18-13-3-1-11(2-4-13)9-12(10-16(21)22)17(23)19-14-5-7-15(8-6-14)20(24)25/h1-8,12H,9-10H2,(H,19,23)(H,21,22)/p-1/t12-/m1/s1 |
| InChIKey | CAISEHBUMJPCHG-GFCCVEGCSA-M |
| XLogP | 2.19 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.76 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|