C18H17N2O5- — CID 7364016
(3R)-3-[(4-methylphenyl)methyl]-4-(3-nitroanilino)-4-oxobutanoate (PubChem CID 7364016) has the molecular formula C18H17N2O5- and a molecular weight of 341.34 g/mol. Its IUPAC name is (3R)-3-[(4-methylphenyl)methyl]-4-(3-nitroanilino)-4-oxobutanoate.
| Compound Name | (3R)-3-[(4-methylphenyl)methyl]-4-(3-nitroanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7364016 |
| Molecular Formula | C18H17N2O5- |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (3R)-3-[(4-methylphenyl)methyl]-4-(3-nitroanilino)-4-oxobutanoate |
| SMILES | Cc1ccc(C[C@H](CC(=O)[O-])C(=O)Nc2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C18H18N2O5/c1-12-5-7-13(8-6-12)9-14(10-17(21)22)18(23)19-15-3-2-4-16(11-15)20(24)25/h2-8,11,14H,9-10H2,1H3,(H,19,23)(H,21,22)/p-1/t14-/m1/s1 |
| InChIKey | GDDQPBOPOSQARD-CQSZACIVSA-M |
| XLogP | 1.84 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|