C17H14ClINO3- — CID 6967220
(3S)-3-[(4-chlorophenyl)methyl]-4-(2-iodoanilino)-4-oxobutanoate (PubChem CID 6967220) has the molecular formula C17H14ClINO3- and a molecular weight of 442.66 g/mol. Its IUPAC name is (3S)-3-[(4-chlorophenyl)methyl]-4-(2-iodoanilino)-4-oxobutanoate.
| Compound Name | (3S)-3-[(4-chlorophenyl)methyl]-4-(2-iodoanilino)-4-oxobutanoate |
|---|---|
| PubChem CID | 6967220 |
| Molecular Formula | C17H14ClINO3- |
| Molecular Weight | 442.66 g/mol |
| Exact Mass | 441.97 |
| IUPAC Name | (3S)-3-[(4-chlorophenyl)methyl]-4-(2-iodoanilino)-4-oxobutanoate |
| SMILES | O=C([O-])C[C@H](Cc1ccc(Cl)cc1)C(=O)Nc1ccccc1I |
| InChI | InChI=1S/C17H15ClINO3/c18-13-7-5-11(6-8-13)9-12(10-16(21)22)17(23)20-15-4-2-1-3-14(15)19/h1-8,12H,9-10H2,(H,20,23)(H,21,22)/p-1/t12-/m0/s1 |
| InChIKey | XGYSGLLEFCOPHM-LBPRGKRZSA-M |
| XLogP | 2.88 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.66 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|