C17H14Cl3NO3 — CID 7340434
(3S)-3-[(4-chlorophenyl)methyl]-4-(3,4-dichloroanilino)-4-oxobutanoic acid (PubChem CID 7340434) has the molecular formula C17H14Cl3NO3 and a molecular weight of 386.66 g/mol. Its IUPAC name is (3S)-3-[(4-chlorophenyl)methyl]-4-(3,4-dichloroanilino)-4-oxobutanoic acid.
| Compound Name | (3S)-3-[(4-chlorophenyl)methyl]-4-(3,4-dichloroanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 7340434 |
| Molecular Formula | C17H14Cl3NO3 |
| Molecular Weight | 386.66 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | (3S)-3-[(4-chlorophenyl)methyl]-4-(3,4-dichloroanilino)-4-oxobutanoic acid |
| SMILES | O=C(O)C[C@H](Cc1ccc(Cl)cc1)C(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H14Cl3NO3/c18-12-3-1-10(2-4-12)7-11(8-16(22)23)17(24)21-13-5-6-14(19)15(20)9-13/h1-6,9,11H,7-8H2,(H,21,24)(H,22,23)/t11-/m0/s1 |
| InChIKey | QQFDCBSRNFLGNQ-NSHDSACASA-N |
| XLogP | 4.92 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.66 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |